C31H32N2O5 — CID 162516428
1-[3-(3-benzyl-2-oxo-4-phenylchromen-7-yl)oxy-2-hydroxypropyl]piperidine-4-carboxamide (PubChem CID 162516428) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-[3-(3-benzyl-2-oxo-4-phenylchromen-7-yl)oxy-2-hydroxypropyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-(3-benzyl-2-oxo-4-phenylchromen-7-yl)oxy-2-hydroxypropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162516428 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 1-[3-(3-benzyl-2-oxo-4-phenylchromen-7-yl)oxy-2-hydroxypropyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CC(O)COc2ccc3c(-c4ccccc4)c(Cc4ccccc4)c(=O)oc3c2)CC1 |
| InChI | InChI=1S/C31H32N2O5/c32-30(35)23-13-15-33(16-14-23)19-24(34)20-37-25-11-12-26-28(18-25)38-31(36)27(17-21-7-3-1-4-8-21)29(26)22-9-5-2-6-10-22/h1-12,18,23-24,34H,13-17,19-20H2,(H2,32,35) |
| InChIKey | WLCHFLOEYFJRGR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|