C32H33FN2O5 — CID 162516438
1-[3-[3-[[4-(4-fluorophenyl)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide (PubChem CID 162516438) has the molecular formula C32H33FN2O5 and a molecular weight of 544.62 g/mol. Its IUPAC name is 1-[3-[3-[[4-(4-fluorophenyl)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[3-[[4-(4-fluorophenyl)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162516438 |
| Molecular Formula | C32H33FN2O5 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 1-[3-[3-[[4-(4-fluorophenyl)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide |
| SMILES | Cc1c(Cc2ccc(-c3ccc(F)cc3)cc2)c(=O)oc2cc(OCC(O)CN3CCC(C(N)=O)CC3)ccc12 |
| InChI | InChI=1S/C32H33FN2O5/c1-20-28-11-10-27(39-19-26(36)18-35-14-12-24(13-15-35)31(34)37)17-30(28)40-32(38)29(20)16-21-2-4-22(5-3-21)23-6-8-25(33)9-7-23/h2-11,17,24,26,36H,12-16,18-19H2,1H3,(H2,34,37) |
| InChIKey | JMPUZXRQUXOGNK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|