C19H14F3N3O5 — CID 139224774
2-methyl-5-(2-nitrobenzoyl)-1-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 139224774) has the molecular formula C19H14F3N3O5 and a molecular weight of 421.33 g/mol. Its IUPAC name is 2-methyl-5-(2-nitrobenzoyl)-1-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,5-benzodiazepin-4-one.
| Compound Name | 2-methyl-5-(2-nitrobenzoyl)-1-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 139224774 |
| Molecular Formula | C19H14F3N3O5 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-methyl-5-(2-nitrobenzoyl)-1-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | CC1CC(=O)N(C(=O)c2ccccc2[N+](=O)[O-])c2ccccc2N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H14F3N3O5/c1-11-10-16(26)24(17(27)12-6-2-3-7-13(12)25(29)30)15-9-5-4-8-14(15)23(11)18(28)19(20,21)22/h2-9,11H,10H2,1H3 |
| InChIKey | GPDXCPJJVIEGAB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|