C21H19N5O4 — CID 139226833
3-O-ethyl 4-O-propan-2-yl 1,1,2,2-tetracyano-6-methyl-9aH-quinolizine-3,4-dicarboxylate (PubChem CID 139226833) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is 3-O-ethyl 4-O-propan-2-yl 1,1,2,2-tetracyano-6-methyl-9aH-quinolizine-3,4-dicarboxylate.
| Compound Name | 3-O-ethyl 4-O-propan-2-yl 1,1,2,2-tetracyano-6-methyl-9aH-quinolizine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 139226833 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-O-ethyl 4-O-propan-2-yl 1,1,2,2-tetracyano-6-methyl-9aH-quinolizine-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OC(C)C)N2C(C)=CC=CC2C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C21H19N5O4/c1-5-29-18(27)16-17(19(28)30-13(2)3)26-14(4)7-6-8-15(26)20(9-22,10-23)21(16,11-24)12-25/h6-8,13,15H,5H2,1-4H3 |
| InChIKey | NLFVPFMDTGORGN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 151.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|