C18H17N3O5 — CID 175138391
diethyl 2,4-dicyano-2-methoxyquinolizine-1,3-dicarboxylate (PubChem CID 175138391) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is diethyl 2,4-dicyano-2-methoxyquinolizine-1,3-dicarboxylate.
| Compound Name | diethyl 2,4-dicyano-2-methoxyquinolizine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175138391 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | diethyl 2,4-dicyano-2-methoxyquinolizine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C#N)N2C=CC=CC2=C(C(=O)OCC)C1(C#N)OC |
| InChI | InChI=1S/C18H17N3O5/c1-4-25-16(22)14-12-8-6-7-9-21(12)13(10-19)15(17(23)26-5-2)18(14,11-20)24-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | CXWPJFYDRADRFU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 112.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |