C17H10N6O2 — CID 139226854
ethyl 1,1,2,2,8-pentacyano-9aH-quinolizine-3-carboxylate (PubChem CID 139226854) has the molecular formula C17H10N6O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is ethyl 1,1,2,2,8-pentacyano-9aH-quinolizine-3-carboxylate.
| Compound Name | ethyl 1,1,2,2,8-pentacyano-9aH-quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 139226854 |
| Molecular Formula | C17H10N6O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | ethyl 1,1,2,2,8-pentacyano-9aH-quinolizine-3-carboxylate |
| SMILES | CCOC(=O)C1=CN2C=CC(C#N)=CC2C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C17H10N6O2/c1-2-25-15(24)13-7-23-4-3-12(6-18)5-14(23)17(10-21,11-22)16(13,8-19)9-20/h3-5,7,14H,2H2,1H3 |
| InChIKey | FYSRCGWQBPLMFM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 148.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|