C17H13N5O2 — CID 139226824
propan-2-yl 1,1,2,2-tetracyano-9aH-quinolizine-3-carboxylate (PubChem CID 139226824) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is propan-2-yl 1,1,2,2-tetracyano-9aH-quinolizine-3-carboxylate.
| Compound Name | propan-2-yl 1,1,2,2-tetracyano-9aH-quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 139226824 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | propan-2-yl 1,1,2,2-tetracyano-9aH-quinolizine-3-carboxylate |
| SMILES | CC(C)OC(=O)C1=CN2C=CC=CC2C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C17H13N5O2/c1-12(2)24-15(23)13-7-22-6-4-3-5-14(22)17(10-20,11-21)16(13,8-18)9-19/h3-7,12,14H,1-2H3 |
| InChIKey | QZDYMPHJFBYTJB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 124.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|