About propan-2-yl 6-methylhepta-2,4-diynoate
propan-2-yl 6-methylhepta-2,4-diynoate (PubChem CID 89414986) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is propan-2-yl 6-methylhepta-2,4-diynoate.
Molecular Properties
| Compound Name | propan-2-yl 6-methylhepta-2,4-diynoate |
| PubChem CID | 89414986 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | propan-2-yl 6-methylhepta-2,4-diynoate |
| SMILES | CC(C)C#CC#CC(=O)OC(C)C |
| InChI | InChI=1S/C11H14O2/c1-9(2)7-5-6-8-11(12)13-10(3)4/h9-10H,1-4H3 |
| InChIKey | WWTJLAHQOOYOMT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 6-methylhepta-2,4-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 6-methylhepta-2,4-diynoate?
The IUPAC name of propan-2-yl 6-methylhepta-2,4-diynoate (CID 89414986) is propan-2-yl 6-methylhepta-2,4-diynoate.
What is the SMILES notation for propan-2-yl 6-methylhepta-2,4-diynoate?
The canonical SMILES for propan-2-yl 6-methylhepta-2,4-diynoate is CC(C)C#CC#CC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 6-methylhepta-2,4-diynoate?
The InChIKey is WWTJLAHQOOYOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-9(2)7-5-6-8-11(12)13-10(3)4/h9-10H,1-4H3.
What are the key properties of propan-2-yl 6-methylhepta-2,4-diynoate?
propan-2-yl 6-methylhepta-2,4-diynoate has a molecular weight of 178.23 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 6-methylhepta-2,4-diynoate is sourced from PubChem (CID 89414986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).