C21H21NO8 — CID 168647731
dimethyl 1-(8-ethoxycarbonyl-2,3-dihydro-1,4-benzodioxin-5-yl)azepine-2,3-dicarboxylate (PubChem CID 168647731) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is dimethyl 1-(8-ethoxycarbonyl-2,3-dihydro-1,4-benzodioxin-5-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(8-ethoxycarbonyl-2,3-dihydro-1,4-benzodioxin-5-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647731 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | dimethyl 1-(8-ethoxycarbonyl-2,3-dihydro-1,4-benzodioxin-5-yl)azepine-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(N2C=CC=CC(C(=O)OC)=C2C(=O)OC)c2c1OCCO2 |
| InChI | InChI=1S/C21H21NO8/c1-4-28-20(24)14-8-9-15(18-17(14)29-11-12-30-18)22-10-6-5-7-13(19(23)26-2)16(22)21(25)27-3/h5-10H,4,11-12H2,1-3H3 |
| InChIKey | NVJHLDHVTUURPV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|