C22H20N2O6 — CID 168649975
dimethyl 1-(2-ethoxycarbonylquinolin-5-yl)azepine-2,3-dicarboxylate (PubChem CID 168649975) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is dimethyl 1-(2-ethoxycarbonylquinolin-5-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-ethoxycarbonylquinolin-5-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649975 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | dimethyl 1-(2-ethoxycarbonylquinolin-5-yl)azepine-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2c(N3C=CC=CC(C(=O)OC)=C3C(=O)OC)cccc2n1 |
| InChI | InChI=1S/C22H20N2O6/c1-4-30-21(26)17-12-11-14-16(23-17)9-7-10-18(14)24-13-6-5-8-15(20(25)28-2)19(24)22(27)29-3/h5-13H,4H2,1-3H3 |
| InChIKey | JNJIQRVLLRXUNJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|