C14H12BrN3O — CID 139228723
2-(2-aminophenyl)-6-bromo-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 139228723) has the molecular formula C14H12BrN3O and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-(2-aminophenyl)-6-bromo-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-(2-aminophenyl)-6-bromo-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 139228723 |
| Molecular Formula | C14H12BrN3O |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-(2-aminophenyl)-6-bromo-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | Nc1ccccc1C1NC(=O)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C14H12BrN3O/c15-8-5-6-12-10(7-8)14(19)18-13(17-12)9-3-1-2-4-11(9)16/h1-7,13,17H,16H2,(H,18,19) |
| InChIKey | VQYWFCMBTFVFGT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|