C19H26BrNO5 — CID 139231254
ethyl (2E)-2-[(3aS,6aR)-5-(2-bromophenyl)-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-ylidene]acetate;methoxymethane (PubChem CID 139231254) has the molecular formula C19H26BrNO5 and a molecular weight of 428.32 g/mol. Its IUPAC name is ethyl (2E)-2-[(3aS,6aR)-5-(2-bromophenyl)-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-ylidene]acetate;methoxymethane.
| Compound Name | ethyl (2E)-2-[(3aS,6aR)-5-(2-bromophenyl)-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-ylidene]acetate;methoxymethane |
|---|---|
| PubChem CID | 139231254 |
| Molecular Formula | C19H26BrNO5 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | ethyl (2E)-2-[(3aS,6aR)-5-(2-bromophenyl)-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-ylidene]acetate;methoxymethane |
| SMILES | CCOC(=O)/C=C1\[C@@H]2OC(C)(C)O[C@@H]2CN1c1ccccc1Br.COC |
| InChI | InChI=1S/C17H20BrNO4.C2H6O/c1-4-21-15(20)9-13-16-14(22-17(2,3)23-16)10-19(13)12-8-6-5-7-11(12)18;1-3-2/h5-9,14,16H,4,10H2,1-3H3;1-2H3/b13-9+;/t14-,16+;/m1./s1 |
| InChIKey | KVWXGVXUFABGQB-DRLIACKCSA-N |
| XLogP | 3.50 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|