C24H26BrNO5 — CID 139231262
ethyl (2E)-2-[(3aS,6aR)-5-(2-bromo-5-phenylmethoxyphenyl)-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-ylidene]acetate (PubChem CID 139231262) has the molecular formula C24H26BrNO5 and a molecular weight of 488.38 g/mol. Its IUPAC name is ethyl (2E)-2-[(3aS,6aR)-5-(2-bromo-5-phenylmethoxyphenyl)-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(3aS,6aR)-5-(2-bromo-5-phenylmethoxyphenyl)-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-ylidene]acetate |
|---|---|
| PubChem CID | 139231262 |
| Molecular Formula | C24H26BrNO5 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | ethyl (2E)-2-[(3aS,6aR)-5-(2-bromo-5-phenylmethoxyphenyl)-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\[C@@H]2OC(C)(C)O[C@@H]2CN1c1cc(OCc2ccccc2)ccc1Br |
| InChI | InChI=1S/C24H26BrNO5/c1-4-28-22(27)13-20-23-21(30-24(2,3)31-23)14-26(20)19-12-17(10-11-18(19)25)29-15-16-8-6-5-7-9-16/h5-13,21,23H,4,14-15H2,1-3H3/b20-13+/t21-,23+/m1/s1 |
| InChIKey | LWXBCYFSIDWSBI-HBQLNJFMSA-N |
| XLogP | 4.82 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|