C22H21NO3 — CID 67409346
ethyl 2-(7-phenylmethoxy-2,3-dihydropyrrolo[1,2-a]indol-1-ylidene)acetate (PubChem CID 67409346) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is ethyl 2-(7-phenylmethoxy-2,3-dihydropyrrolo[1,2-a]indol-1-ylidene)acetate.
| Compound Name | ethyl 2-(7-phenylmethoxy-2,3-dihydropyrrolo[1,2-a]indol-1-ylidene)acetate |
|---|---|
| PubChem CID | 67409346 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl 2-(7-phenylmethoxy-2,3-dihydropyrrolo[1,2-a]indol-1-ylidene)acetate |
| SMILES | CCOC(=O)C=C1CCc2cc3ccc(OCc4ccccc4)cc3n21 |
| InChI | InChI=1S/C22H21NO3/c1-2-25-22(24)13-19-10-9-18-12-17-8-11-20(14-21(17)23(18)19)26-15-16-6-4-3-5-7-16/h3-8,11-14H,2,9-10,15H2,1H3 |
| InChIKey | WBVOHPLGXZGJTQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|