C40H42O8 — CID 162034346
ethyl (2E)-2-(7-phenylmethoxy-2,3-dihydrochromen-4-ylidene)acetate;oxolane;7-phenylmethoxy-2,3-dihydrochromen-4-one (PubChem CID 162034346) has the molecular formula C40H42O8 and a molecular weight of 650.77 g/mol. Its IUPAC name is ethyl (2E)-2-(7-phenylmethoxy-2,3-dihydrochromen-4-ylidene)acetate;oxolane;7-phenylmethoxy-2,3-dihydrochromen-4-one.
| Compound Name | ethyl (2E)-2-(7-phenylmethoxy-2,3-dihydrochromen-4-ylidene)acetate;oxolane;7-phenylmethoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162034346 |
| Molecular Formula | C40H42O8 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | ethyl (2E)-2-(7-phenylmethoxy-2,3-dihydrochromen-4-ylidene)acetate;oxolane;7-phenylmethoxy-2,3-dihydrochromen-4-one |
| SMILES | C1CCOC1.CCOC(=O)/C=C1\CCOc2cc(OCc3ccccc3)ccc21.O=C1CCOc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H20O4.C16H14O3.C4H8O/c1-2-22-20(21)12-16-10-11-23-19-13-17(8-9-18(16)19)24-14-15-6-4-3-5-7-15;17-15-8-9-18-16-10-13(6-7-14(15)16)19-11-12-4-2-1-3-5-12;1-2-4-5-3-1/h3-9,12-13H,2,10-11,14H2,1H3;1-7,10H,8-9,11H2;1-4H2/b16-12+;; |
| InChIKey | YWLGELZYPMLJNU-LPMXOWGUSA-N |
| XLogP | 8.02 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|