C22H19ClN8O2S — CID 139231905
ethyl 4-azido-1-(4-chlorophenyl)-3-(5-ethylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)pyrazole-5-carboxylate (PubChem CID 139231905) has the molecular formula C22H19ClN8O2S and a molecular weight of 494.97 g/mol. Its IUPAC name is ethyl 4-azido-1-(4-chlorophenyl)-3-(5-ethylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)pyrazole-5-carboxylate.
| Compound Name | ethyl 4-azido-1-(4-chlorophenyl)-3-(5-ethylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 139231905 |
| Molecular Formula | C22H19ClN8O2S |
| Molecular Weight | 494.97 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | ethyl 4-azido-1-(4-chlorophenyl)-3-(5-ethylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(N=[N+]=[N-])c(-c2nnc(SCC)n2-c2ccccc2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClN8O2S/c1-3-33-21(32)19-17(25-29-24)18(28-31(19)16-12-10-14(23)11-13-16)20-26-27-22(34-4-2)30(20)15-8-6-5-7-9-15/h5-13H,3-4H2,1-2H3 |
| InChIKey | ZPDNUYCQPLXKME-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 123.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.97 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|