C21H14F3N3O2 — CID 139231952
3-(furan-2-ylmethyl)-5-phenyl-1-prop-2-ynyl-7-(trifluoromethyl)imidazo[4,5-b]pyridin-2-one (PubChem CID 139231952) has the molecular formula C21H14F3N3O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-5-phenyl-1-prop-2-ynyl-7-(trifluoromethyl)imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-(furan-2-ylmethyl)-5-phenyl-1-prop-2-ynyl-7-(trifluoromethyl)imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 139231952 |
| Molecular Formula | C21H14F3N3O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-(furan-2-ylmethyl)-5-phenyl-1-prop-2-ynyl-7-(trifluoromethyl)imidazo[4,5-b]pyridin-2-one |
| SMILES | C#CCn1c(=O)n(Cc2ccco2)c2nc(-c3ccccc3)cc(C(F)(F)F)c21 |
| InChI | InChI=1S/C21H14F3N3O2/c1-2-10-26-18-16(21(22,23)24)12-17(14-7-4-3-5-8-14)25-19(18)27(20(26)28)13-15-9-6-11-29-15/h1,3-9,11-12H,10,13H2 |
| InChIKey | RGJCOPYUOHBBKT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|