C17H13N5O5 — CID 139232251
4-[[1-(3-hydroxyphenyl)triazol-4-yl]methyl]-7-nitro-1,4-benzoxazin-3-one (PubChem CID 139232251) has the molecular formula C17H13N5O5 and a molecular weight of 367.32 g/mol. Its IUPAC name is 4-[[1-(3-hydroxyphenyl)triazol-4-yl]methyl]-7-nitro-1,4-benzoxazin-3-one.
| Compound Name | 4-[[1-(3-hydroxyphenyl)triazol-4-yl]methyl]-7-nitro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 139232251 |
| Molecular Formula | C17H13N5O5 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[[1-(3-hydroxyphenyl)triazol-4-yl]methyl]-7-nitro-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc([N+](=O)[O-])ccc2N1Cc1cn(-c2cccc(O)c2)nn1 |
| InChI | InChI=1S/C17H13N5O5/c23-14-3-1-2-12(6-14)21-9-11(18-19-21)8-20-15-5-4-13(22(25)26)7-16(15)27-10-17(20)24/h1-7,9,23H,8,10H2 |
| InChIKey | MRSSIJKKOKIWBY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|