C26H26S4 — CID 139233035
1-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-3-(5-hexylthiophen-2-yl)-2-benzothiophene (PubChem CID 139233035) has the molecular formula C26H26S4 and a molecular weight of 466.76 g/mol. Its IUPAC name is 1-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-3-(5-hexylthiophen-2-yl)-2-benzothiophene.
| Compound Name | 1-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-3-(5-hexylthiophen-2-yl)-2-benzothiophene |
|---|---|
| PubChem CID | 139233035 |
| Molecular Formula | C26H26S4 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 1-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-3-(5-hexylthiophen-2-yl)-2-benzothiophene |
| SMILES | CCCCCCc1ccc(-c2sc(-c3sc4scc(C)c4c3C)c3ccccc23)s1 |
| InChI | InChI=1S/C26H26S4/c1-4-5-6-7-10-18-13-14-21(28-18)24-19-11-8-9-12-20(19)25(29-24)23-17(3)22-16(2)15-27-26(22)30-23/h8-9,11-15H,4-7,10H2,1-3H3 |
| InChIKey | MAIVYXMJLPHVCD-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|