C11H14N2O3 — CID 139234362
5-methoxy-2,3-dimethyl-7-nitro-2,3-dihydro-1H-indole (PubChem CID 139234362) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 5-methoxy-2,3-dimethyl-7-nitro-2,3-dihydro-1H-indole.
| Compound Name | 5-methoxy-2,3-dimethyl-7-nitro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 139234362 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 5-methoxy-2,3-dimethyl-7-nitro-2,3-dihydro-1H-indole |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1)NC(C)C2C |
| InChI | InChI=1S/C11H14N2O3/c1-6-7(2)12-11-9(6)4-8(16-3)5-10(11)13(14)15/h4-7,12H,1-3H3 |
| InChIKey | PZXSSDRHXPUMEY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|