C17H11N5 — CID 139236372
2-anilino-6-pyrrol-1-ylpyridine-3,5-dicarbonitrile (PubChem CID 139236372) has the molecular formula C17H11N5 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-anilino-6-pyrrol-1-ylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-anilino-6-pyrrol-1-ylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 139236372 |
| Molecular Formula | C17H11N5 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-anilino-6-pyrrol-1-ylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c(-n2cccc2)nc1Nc1ccccc1 |
| InChI | InChI=1S/C17H11N5/c18-11-13-10-14(12-19)17(22-8-4-5-9-22)21-16(13)20-15-6-2-1-3-7-15/h1-10H,(H,20,21) |
| InChIKey | DJGORLZHQKIKHS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |