C26H29FeNO5 — CID 139238734
[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 139238734) has the molecular formula C26H29FeNO5 and a molecular weight of 491.37 g/mol. Its IUPAC name is [[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | [[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 139238734 |
| Molecular Formula | C26H29FeNO5 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC1(C)O[C@H]2O[C@H](CNC([O-])=C3C=CC=C3)[C@H](OCc3ccccc3)[C@H]2O1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C21H25NO5.C5H5.Fe/c1-21(2)26-18-17(24-13-14-8-4-3-5-9-14)16(25-20(18)27-21)12-22-19(23)15-10-6-7-11-15;1-2-4-5-3-1;/h3-11,16-18,20,22-23H,12-13H2,1-2H3;1-5H;/q;-1;+2/p-1/t16-,17+,18-,20-;;/m1../s1 |
| InChIKey | MXZYMAYGVBBZEJ-DJLCDRMGSA-M |
| XLogP | 3.14 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|