C17H19NO5S — CID 72793501
4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3H-1,3-oxazole-2-thione (PubChem CID 72793501) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3H-1,3-oxazole-2-thione.
| Compound Name | 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 72793501 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3H-1,3-oxazole-2-thione |
| SMILES | CC1(C)O[C@H]2O[C@H](c3coc(=S)[nH]3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C17H19NO5S/c1-17(2)22-14-13(19-8-10-6-4-3-5-7-10)12(21-15(14)23-17)11-9-20-16(24)18-11/h3-7,9,12-15H,8H2,1-2H3,(H,18,24)/t12-,13+,14-,15-/m1/s1 |
| InChIKey | SHMIWVUSQMMMMB-LXTVHRRPSA-N |
| XLogP | 3.47 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|