C15H19NO4S — CID 11335861
(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbothioamide (PubChem CID 11335861) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbothioamide.
| Compound Name | (3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbothioamide |
|---|---|
| PubChem CID | 11335861 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbothioamide |
| SMILES | CC1(C)O[C@H]2O[C@H](C(N)=S)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C15H19NO4S/c1-15(2)19-12-10(11(13(16)21)18-14(12)20-15)17-8-9-6-4-3-5-7-9/h3-7,10-12,14H,8H2,1-2H3,(H2,16,21)/t10-,11+,12-,14-/m1/s1 |
| InChIKey | OJBJRHMQJJDAMX-GFQSEFKGSA-N |
| XLogP | 1.73 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|