C34H35F2N2Pd+ — CID 139240473
2-N,3-N-bis[4-fluoro-2-(1-phenylethyl)phenyl]butane-2,3-diimine;ethane;palladium(2+) (PubChem CID 139240473) has the molecular formula C34H35F2N2Pd+ and a molecular weight of 616.08 g/mol. Its IUPAC name is 2-N,3-N-bis[4-fluoro-2-(1-phenylethyl)phenyl]butane-2,3-diimine;ethane;palladium(2+).
| Compound Name | 2-N,3-N-bis[4-fluoro-2-(1-phenylethyl)phenyl]butane-2,3-diimine;ethane;palladium(2+) |
|---|---|
| PubChem CID | 139240473 |
| Molecular Formula | C34H35F2N2Pd+ |
| Molecular Weight | 616.08 g/mol |
| Exact Mass | 615.18 |
| IUPAC Name | 2-N,3-N-bis[4-fluoro-2-(1-phenylethyl)phenyl]butane-2,3-diimine;ethane;palladium(2+) |
| SMILES | CC(=N\c1ccc(F)cc1C(C)c1ccccc1)/C(C)=N/c1ccc(F)cc1C(C)c1ccccc1.[CH2-]C.[Pd+2] |
| InChI | InChI=1S/C32H30F2N2.C2H5.Pd/c1-21(25-11-7-5-8-12-25)29-19-27(33)15-17-31(29)35-23(3)24(4)36-32-18-16-28(34)20-30(32)22(2)26-13-9-6-10-14-26;1-2;/h5-22H,1-4H3;1H2,2H3;/q;-1;+2/b35-23+,36-24+;; |
| InChIKey | HUUGNGJNFKFSLF-GLGPYLFJSA-N |
| XLogP | 9.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.08 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|