C34H36Cl2N2Pd — CID 139240981
2-N,3-N-bis[4-methyl-2-(1-phenylethyl)phenyl]butane-2,3-diimine;dichloropalladium (PubChem CID 139240981) has the molecular formula C34H36Cl2N2Pd and a molecular weight of 650.00 g/mol. Its IUPAC name is 2-N,3-N-bis[4-methyl-2-(1-phenylethyl)phenyl]butane-2,3-diimine;dichloropalladium.
| Compound Name | 2-N,3-N-bis[4-methyl-2-(1-phenylethyl)phenyl]butane-2,3-diimine;dichloropalladium |
|---|---|
| PubChem CID | 139240981 |
| Molecular Formula | C34H36Cl2N2Pd |
| Molecular Weight | 650.00 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | 2-N,3-N-bis[4-methyl-2-(1-phenylethyl)phenyl]butane-2,3-diimine;dichloropalladium |
| SMILES | CC(=N\c1ccc(C)cc1C(C)c1ccccc1)/C(C)=N/c1ccc(C)cc1C(C)c1ccccc1.Cl[Pd]Cl |
| InChI | InChI=1S/C34H36N2.2ClH.Pd/c1-23-17-19-33(31(21-23)25(3)29-13-9-7-10-14-29)35-27(5)28(6)36-34-20-18-24(2)22-32(34)26(4)30-15-11-8-12-16-30;;;/h7-22,25-26H,1-6H3;2*1H;/q;;;+2/p-2/b35-27+,36-28+;;; |
| InChIKey | RBOBBXKVGJBRDC-OHBQAROBSA-L |
| XLogP | 10.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.00 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|