C36H39N2Ni- — CID 176916207
3-N-(2-benzhydryl-4-methylphenyl)-2-N-[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine;nickel (PubChem CID 176916207) has the molecular formula C36H39N2Ni- and a molecular weight of 558.42 g/mol. Its IUPAC name is 3-N-(2-benzhydryl-4-methylphenyl)-2-N-[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine;nickel.
| Compound Name | 3-N-(2-benzhydryl-4-methylphenyl)-2-N-[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine;nickel |
|---|---|
| PubChem CID | 176916207 |
| Molecular Formula | C36H39N2Ni- |
| Molecular Weight | 558.42 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 3-N-(2-benzhydryl-4-methylphenyl)-2-N-[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine;nickel |
| SMILES | [CH2-]C(=N/c1ccc(C)cc1C(c1ccccc1)c1ccccc1)/C(C)=N/c1c(C(C)C)cccc1C(C)C.[Ni] |
| InChI | InChI=1S/C36H39N2.Ni/c1-24(2)31-19-14-20-32(25(3)4)36(31)38-28(7)27(6)37-34-22-21-26(5)23-33(34)35(29-15-10-8-11-16-29)30-17-12-9-13-18-30;/h8-25,35H,6H2,1-5,7H3;/q-1;/b37-27-,38-28+; |
| InChIKey | ZXKKUQDMYPYDRO-GDXNRESUSA-N |
| XLogP | 10.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.42 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|