About tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate
tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate (PubChem CID 139242356) has the molecular formula C32H41NO4Sn
and a molecular weight of 622.39 g/mol. Its IUPAC name is tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate.
Molecular Properties
| Compound Name | tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate |
| PubChem CID | 139242356 |
| Molecular Formula | C32H41NO4Sn |
| Molecular Weight | 622.39 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate |
| SMILES | CC(=O)/C=C(/C)N[C@@H](CC(C)C)C(=O)O[Sn](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1.O |
| InChI | InChI=1S/C11H19NO3.3C7H7.H2O.Sn/c1-7(2)5-10(11(14)15)12-8(3)6-9(4)13;3*1-7-5-3-2-4-6-7;;/h6-7,10,12H,5H2,1-4H3,(H,14,15);3*2-6H,1H2;1H2;/q;;;;;+1/p-1/b8-6-;;;;;/t10-;;;;;/m0...../s1 |
| InChIKey | KIAHMANGCDLHPH-DLBDEGGASA-M |
| XLogP | 5.49 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 622.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate?
The IUPAC name of tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate (CID 139242356) is tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate.
What is the SMILES notation for tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate?
The canonical SMILES for tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate is CC(=O)/C=C(/C)N[C@@H](CC(C)C)C(=O)O[Sn](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1.O.
What is the InChIKey of tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate?
The InChIKey is KIAHMANGCDLHPH-DLBDEGGASA-M. The full InChI is InChI=1S/C11H19NO3.3C7H7.H2O.Sn/c1-7(2)5-10(11(14)15)12-8(3)6-9(4)13;3*1-7-5-3-2-4-6-7;;/h6-7,10,12H,5H2,1-4H3,(H,14,15);3*2-6H,1H2;1H2;/q;;;;;+1/p-1/b8-6-;;;;;/t10-;;;;;/m0...../s1.
What are the key properties of tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate?
tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate has a molecular weight of 622.39 g/mol, XLogP of 5.49, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tribenzylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate;hydrate is sourced from PubChem (CID 139242356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).