About 3,5-dicyanophenolate
3,5-dicyanophenolate (PubChem CID 139243771) has the molecular formula C8H3N2O-
and a molecular weight of 143.12 g/mol. Its IUPAC name is 3,5-dicyanophenolate.
Molecular Properties
| Compound Name | 3,5-dicyanophenolate |
| PubChem CID | 139243771 |
| Molecular Formula | C8H3N2O- |
| Molecular Weight | 143.12 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | 3,5-dicyanophenolate |
| SMILES | N#Cc1cc([O-])cc(C#N)c1 |
| InChI | InChI=1S/C8H4N2O/c9-4-6-1-7(5-10)3-8(11)2-6/h1-3,11H/p-1 |
| InChIKey | CHASTCUDJNQBOZ-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.12 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dicyanophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dicyanophenolate?
The IUPAC name of 3,5-dicyanophenolate (CID 139243771) is 3,5-dicyanophenolate.
What is the SMILES notation for 3,5-dicyanophenolate?
The canonical SMILES for 3,5-dicyanophenolate is N#Cc1cc([O-])cc(C#N)c1.
What is the InChIKey of 3,5-dicyanophenolate?
The InChIKey is CHASTCUDJNQBOZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H4N2O/c9-4-6-1-7(5-10)3-8(11)2-6/h1-3,11H/p-1.
What are the key properties of 3,5-dicyanophenolate?
3,5-dicyanophenolate has a molecular weight of 143.12 g/mol, XLogP of 0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dicyanophenolate is sourced from PubChem (CID 139243771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).