C19H37NS2 — CID 139245712
11-[[(2Z,6E)-2-sulfanylocta-2,6-dien-3-yl]amino]undecane-1-thiol (PubChem CID 139245712) has the molecular formula C19H37NS2 and a molecular weight of 343.65 g/mol. Its IUPAC name is 11-[[(2Z,6E)-2-sulfanylocta-2,6-dien-3-yl]amino]undecane-1-thiol.
| Compound Name | 11-[[(2Z,6E)-2-sulfanylocta-2,6-dien-3-yl]amino]undecane-1-thiol |
|---|---|
| PubChem CID | 139245712 |
| Molecular Formula | C19H37NS2 |
| Molecular Weight | 343.65 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 11-[[(2Z,6E)-2-sulfanylocta-2,6-dien-3-yl]amino]undecane-1-thiol |
| SMILES | C/C=C/CC/C(NCCCCCCCCCCCS)=C(\C)S |
| InChI | InChI=1S/C19H37NS2/c1-3-4-12-15-19(18(2)22)20-16-13-10-8-6-5-7-9-11-14-17-21/h3-4,20-22H,5-17H2,1-2H3/b4-3+,19-18- |
| InChIKey | UARWIUYSWYPVBT-ISWWZEDDSA-N |
| XLogP | 6.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|