C11H16N2O — CID 139247445
(1R,4S,9R,13S)-2,8-diazatetracyclo[7.4.0.02,13.04,8]tridecan-3-one (PubChem CID 139247445) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R,4S,9R,13S)-2,8-diazatetracyclo[7.4.0.02,13.04,8]tridecan-3-one.
| Compound Name | (1R,4S,9R,13S)-2,8-diazatetracyclo[7.4.0.02,13.04,8]tridecan-3-one |
|---|---|
| PubChem CID | 139247445 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (1R,4S,9R,13S)-2,8-diazatetracyclo[7.4.0.02,13.04,8]tridecan-3-one |
| SMILES | O=C1[C@@H]2CCCN2[C@@H]2CCC[C@H]3[C@@H]2N13 |
| InChI | InChI=1S/C11H16N2O/c14-11-9-5-2-6-12(9)7-3-1-4-8-10(7)13(8)11/h7-10H,1-6H2/t7-,8+,9+,10-,13?/m1/s1 |
| InChIKey | DVPDIQAOCSMNNP-ZVQBVKBTSA-N |
| XLogP | 0.60 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|