C20H37N3O3Si — CID 46927400
(2R,3S,4S,7S)-N-tert-butyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-1,5-diazatricyclo[5.3.0.03,5]decane-2-carboxamide (PubChem CID 46927400) has the molecular formula C20H37N3O3Si and a molecular weight of 395.62 g/mol. Its IUPAC name is (2R,3S,4S,7S)-N-tert-butyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-1,5-diazatricyclo[5.3.0.03,5]decane-2-carboxamide.
| Compound Name | (2R,3S,4S,7S)-N-tert-butyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-1,5-diazatricyclo[5.3.0.03,5]decane-2-carboxamide |
|---|---|
| PubChem CID | 46927400 |
| Molecular Formula | C20H37N3O3Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (2R,3S,4S,7S)-N-tert-butyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-1,5-diazatricyclo[5.3.0.03,5]decane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@H]1[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)N2C(=O)[C@@H]2CCCN21 |
| InChI | InChI=1S/C20H37N3O3Si/c1-19(2,3)21-17(24)16-15-14(12-26-27(7,8)20(4,5)6)23(15)18(25)13-10-9-11-22(13)16/h13-16H,9-12H2,1-8H3,(H,21,24)/t13-,14+,15-,16+,23?/m0/s1 |
| InChIKey | MULOEKHNNQVSCM-AXMGPVGOSA-N |
| XLogP | 2.35 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|