4-cyclohexylpent-4-enoic acid

C11H18O2 — CID 139247616

IUPAC4-cyclohexylpent-4-enoic acid
SMILESC=C(CCC(=O)O)C1CCCCC1
InChIInChI=1S/C11H18O2/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h10H,1-8H2,(H,12,13)
InChIKeyLHXNFOJWWGVIOU-UHFFFAOYSA-N
MW182.26 g/mol
LogP2.99
Rot. Bonds4

About 4-cyclohexylpent-4-enoic acid

4-cyclohexylpent-4-enoic acid (PubChem CID 139247616) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 4-cyclohexylpent-4-enoic acid.

Molecular Properties

Compound Name4-cyclohexylpent-4-enoic acid
PubChem CID139247616
Molecular FormulaC11H18O2
Molecular Weight182.26 g/mol
Exact Mass182.13
IUPAC Name4-cyclohexylpent-4-enoic acid
SMILESC=C(CCC(=O)O)C1CCCCC1
InChIInChI=1S/C11H18O2/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h10H,1-8H2,(H,12,13)
InChIKeyLHXNFOJWWGVIOU-UHFFFAOYSA-N
XLogP2.99
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.26
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-cyclohexylpent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-cyclohexylpent-4-enoic acid?
The IUPAC name of 4-cyclohexylpent-4-enoic acid (CID 139247616) is 4-cyclohexylpent-4-enoic acid.
What is the SMILES notation for 4-cyclohexylpent-4-enoic acid?
The canonical SMILES for 4-cyclohexylpent-4-enoic acid is C=C(CCC(=O)O)C1CCCCC1.
What is the InChIKey of 4-cyclohexylpent-4-enoic acid?
The InChIKey is LHXNFOJWWGVIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h10H,1-8H2,(H,12,13).
What are the key properties of 4-cyclohexylpent-4-enoic acid?
4-cyclohexylpent-4-enoic acid has a molecular weight of 182.26 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylpent-4-enoic acid is sourced from PubChem (CID 139247616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).