C15H21NO3S3 — CID 139247958
[(4R)-2-butylsulfanyl-4,5-dihydro-1,3-thiazol-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 139247958) has the molecular formula C15H21NO3S3 and a molecular weight of 359.54 g/mol. Its IUPAC name is [(4R)-2-butylsulfanyl-4,5-dihydro-1,3-thiazol-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R)-2-butylsulfanyl-4,5-dihydro-1,3-thiazol-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139247958 |
| Molecular Formula | C15H21NO3S3 |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | [(4R)-2-butylsulfanyl-4,5-dihydro-1,3-thiazol-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCCCSC1=N[C@H](COS(=O)(=O)c2ccc(C)cc2)CS1 |
| InChI | InChI=1S/C15H21NO3S3/c1-3-4-9-20-15-16-13(11-21-15)10-19-22(17,18)14-7-5-12(2)6-8-14/h5-8,13H,3-4,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | OTEGDQGZYQRBQS-CYBMUJFWSA-N |
| XLogP | 3.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|