C18H19NO3S3 — CID 139247959
[(4R)-2-benzylsulfanyl-4,5-dihydro-1,3-thiazol-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 139247959) has the molecular formula C18H19NO3S3 and a molecular weight of 393.56 g/mol. Its IUPAC name is [(4R)-2-benzylsulfanyl-4,5-dihydro-1,3-thiazol-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R)-2-benzylsulfanyl-4,5-dihydro-1,3-thiazol-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139247959 |
| Molecular Formula | C18H19NO3S3 |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | [(4R)-2-benzylsulfanyl-4,5-dihydro-1,3-thiazol-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CSC(SCc3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C18H19NO3S3/c1-14-7-9-17(10-8-14)25(20,21)22-11-16-13-24-18(19-16)23-12-15-5-3-2-4-6-15/h2-10,16H,11-13H2,1H3/t16-/m1/s1 |
| InChIKey | GEAUJYMUGIWBCR-MRXNPFEDSA-N |
| XLogP | 4.11 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|