C11H14N2O3S2 — CID 141047243
(2-amino-4,5-dihydro-1,3-thiazol-4-yl)methyl 4-methylbenzenesulfonate (PubChem CID 141047243) has the molecular formula C11H14N2O3S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (2-amino-4,5-dihydro-1,3-thiazol-4-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (2-amino-4,5-dihydro-1,3-thiazol-4-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 141047243 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | (2-amino-4,5-dihydro-1,3-thiazol-4-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CSC(N)=N2)cc1 |
| InChI | InChI=1S/C11H14N2O3S2/c1-8-2-4-10(5-3-8)18(14,15)16-6-9-7-17-11(12)13-9/h2-5,9H,6-7H2,1H3,(H2,12,13) |
| InChIKey | JZZAZGHXIRKYPR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|