C13H20NO3S2+ — CID 57204412
(3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methyl 4-methylbenzenesulfonate (PubChem CID 57204412) has the molecular formula C13H20NO3S2+ and a molecular weight of 302.44 g/mol. Its IUPAC name is (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57204412 |
| Molecular Formula | C13H20NO3S2+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (3,3-dimethyl-1,3-thiazolidin-3-ium-4-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CSC[N+]2(C)C)cc1 |
| InChI | InChI=1S/C13H20NO3S2/c1-11-4-6-13(7-5-11)19(15,16)17-8-12-9-18-10-14(12,2)3/h4-7,12H,8-10H2,1-3H3/q+1 |
| InChIKey | UYRGLCICAHDTIS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|