C17H24O4S — CID 139250266
(3aR,4S,6S,7S,7aR)-4-(2,6-dimethylphenyl)sulfanyl-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 139250266) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is (3aR,4S,6S,7S,7aR)-4-(2,6-dimethylphenyl)sulfanyl-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aR,4S,6S,7S,7aR)-4-(2,6-dimethylphenyl)sulfanyl-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 139250266 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (3aR,4S,6S,7S,7aR)-4-(2,6-dimethylphenyl)sulfanyl-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | Cc1cccc(C)c1S[C@@H]1O[C@@H](C)[C@H](O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H24O4S/c1-9-7-6-8-10(2)15(9)22-16-14-13(12(18)11(3)19-16)20-17(4,5)21-14/h6-8,11-14,16,18H,1-5H3/t11-,12-,13+,14+,16-/m0/s1 |
| InChIKey | ZUWUWZVAFPUZDC-JAAXMTQOSA-N |
| XLogP | 3.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |