C20H38O4Si — CID 139252224
ethyl (2E,4E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-4,6-dimethyldeca-2,4-dienoate (PubChem CID 139252224) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-4,6-dimethyldeca-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-4,6-dimethyldeca-2,4-dienoate |
|---|---|
| PubChem CID | 139252224 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | ethyl (2E,4E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-4,6-dimethyldeca-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/[C@@H](C)[C@@H](CC(C)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-10-23-19(22)12-11-15(2)13-16(3)18(14-17(4)21)24-25(8,9)20(5,6)7/h11-13,16-18,21H,10,14H2,1-9H3/b12-11+,15-13+/t16-,17?,18-/m1/s1 |
| InChIKey | DUXZBICIPHCYHN-YSIKADFBSA-N |
| XLogP | 4.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|