C24H48O3Si — CID 139253923
(2S,4R)-4-[(1S,3R,4R)-2,2-dimethyl-4-prop-1-en-2-yl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol (PubChem CID 139253923) has the molecular formula C24H48O3Si and a molecular weight of 412.73 g/mol. Its IUPAC name is (2S,4R)-4-[(1S,3R,4R)-2,2-dimethyl-4-prop-1-en-2-yl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol.
| Compound Name | (2S,4R)-4-[(1S,3R,4R)-2,2-dimethyl-4-prop-1-en-2-yl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol |
|---|---|
| PubChem CID | 139253923 |
| Molecular Formula | C24H48O3Si |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.34 |
| IUPAC Name | (2S,4R)-4-[(1S,3R,4R)-2,2-dimethyl-4-prop-1-en-2-yl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol |
| SMILES | C=C(C)[C@H]1C[C@H](O[C@H](C)C[C@H](C)O)C(C)(C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H48O3Si/c1-15(2)21-14-22(26-20(10)13-19(9)25)24(11,12)23(21)27-28(16(3)4,17(5)6)18(7)8/h16-23,25H,1,13-14H2,2-12H3/t19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | MTSIMFDUXBGSMK-BVAFDOMYSA-N |
| XLogP | 6.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|