C56H52FeN5O14- — CID 139255726
iron(2+);5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-22,24-diide;nitrite (PubChem CID 139255726) has the molecular formula C56H52FeN5O14- and a molecular weight of 1074.90 g/mol. Its IUPAC name is iron(2+);5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-22,24-diide;nitrite.
| Compound Name | iron(2+);5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-22,24-diide;nitrite |
|---|---|
| PubChem CID | 139255726 |
| Molecular Formula | C56H52FeN5O14- |
| Molecular Weight | 1074.90 g/mol |
| Exact Mass | 1074.29 |
| IUPAC Name | iron(2+);5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-22,24-diide;nitrite |
| SMILES | COc1cc(-c2c3nc(c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([n-]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc(c(-c5cc(OC)c(OC)c(OC)c5)c5ccc2[n-]5)C=C4)C=C3)cc(OC)c1OC.O=N[O-].[Fe+2] |
| InChI | InChI=1S/C56H52N4O12.Fe.HNO2/c1-61-41-21-29(22-42(62-2)53(41)69-9)49-33-13-15-35(57-33)50(30-23-43(63-3)54(70-10)44(24-30)64-4)37-17-19-39(59-37)52(32-27-47(67-7)56(72-12)48(28-32)68-8)40-20-18-38(60-40)51(36-16-14-34(49)58-36)31-25-45(65-5)55(71-11)46(26-31)66-6;;2-1-3/h13-28H,1-12H3;;(H,2,3)/q-2;+2;/p-1/b49-33-,49-34-,50-35-,50-37-,51-36-,51-38-,52-39-,52-40-;; |
| InChIKey | YSUHQENXGNFVGI-FROCSNILSA-M |
| XLogP | 10.93 |
| TPSA | 217.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1074.90 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|