C43H45NO3S2 — CID 139256580
5-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)naphthalen-1-yl]thiophen-2-yl]thiophene-2-carbaldehyde (PubChem CID 139256580) has the molecular formula C43H45NO3S2 and a molecular weight of 687.97 g/mol. Its IUPAC name is 5-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)naphthalen-1-yl]thiophen-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)naphthalen-1-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139256580 |
| Molecular Formula | C43H45NO3S2 |
| Molecular Weight | 687.97 g/mol |
| Exact Mass | 687.28 |
| IUPAC Name | 5-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)naphthalen-1-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3ccc(-c4ccc(C=O)s4)s3)c3ccccc23)cc1 |
| InChI | InChI=1S/C43H45NO3S2/c1-3-5-7-11-29-46-34-19-15-32(16-20-34)44(33-17-21-35(22-18-33)47-30-12-8-6-4-2)40-25-24-39(37-13-9-10-14-38(37)40)41-27-28-43(49-41)42-26-23-36(31-45)48-42/h9-10,13-28,31H,3-8,11-12,29-30H2,1-2H3 |
| InChIKey | SKVASAKNUHIZQV-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.97 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|