C17H32O5 — CID 139258189
(E,1S)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methyloct-2-en-1-ol (PubChem CID 139258189) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is (E,1S)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methyloct-2-en-1-ol.
| Compound Name | (E,1S)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methyloct-2-en-1-ol |
|---|---|
| PubChem CID | 139258189 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (E,1S)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methyloct-2-en-1-ol |
| SMILES | CCCCC/C(C)=C/[C@H](O)[C@@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C17H32O5/c1-7-8-9-10-13(2)11-14(18)15-12-21-16(3,19-5)17(4,20-6)22-15/h11,14-15,18H,7-10,12H2,1-6H3/b13-11+/t14-,15-,16+,17+/m0/s1 |
| InChIKey | YGPJSBNLSSQCFP-BSCZTZGSSA-N |
| XLogP | 3.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|