C16H30O5 — CID 139258193
(E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3,4,4-trimethylpent-2-en-1-ol (PubChem CID 139258193) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3,4,4-trimethylpent-2-en-1-ol.
| Compound Name | (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3,4,4-trimethylpent-2-en-1-ol |
|---|---|
| PubChem CID | 139258193 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3,4,4-trimethylpent-2-en-1-ol |
| SMILES | CO[C@]1(C)OC[C@@H]([C@H](O)/C=C(\C)C(C)(C)C)O[C@@]1(C)OC |
| InChI | InChI=1S/C16H30O5/c1-11(14(2,3)4)9-12(17)13-10-20-15(5,18-7)16(6,19-8)21-13/h9,12-13,17H,10H2,1-8H3/b11-9+/t12-,13+,15-,16-/m1/s1 |
| InChIKey | CIIZPCWEFOFFKC-IJLXLNPRSA-N |
| XLogP | 2.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|