C18H34O5 — CID 102191667
(E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylnon-2-en-1-ol (PubChem CID 102191667) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylnon-2-en-1-ol.
| Compound Name | (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylnon-2-en-1-ol |
|---|---|
| PubChem CID | 102191667 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (E,1R)-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-methylnon-2-en-1-ol |
| SMILES | CCCCCC/C(C)=C/[C@@H](O)[C@@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C18H34O5/c1-7-8-9-10-11-14(2)12-15(19)16-13-22-17(3,20-5)18(4,21-6)23-16/h12,15-16,19H,7-11,13H2,1-6H3/b14-12+/t15-,16+,17-,18-/m1/s1 |
| InChIKey | XZOWRQHTITXZGT-RVMRAXKISA-N |
| XLogP | 3.40 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|