C15H26O5 — CID 139258197
(E,1R)-3-cyclopropyl-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-2-en-1-ol (PubChem CID 139258197) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (E,1R)-3-cyclopropyl-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-2-en-1-ol.
| Compound Name | (E,1R)-3-cyclopropyl-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 139258197 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (E,1R)-3-cyclopropyl-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-2-en-1-ol |
| SMILES | CO[C@]1(C)OC[C@@H]([C@H](O)/C=C(\C)C2CC2)O[C@@]1(C)OC |
| InChI | InChI=1S/C15H26O5/c1-10(11-6-7-11)8-12(16)13-9-19-14(2,17-4)15(3,18-5)20-13/h8,11-13,16H,6-7,9H2,1-5H3/b10-8+/t12-,13+,14-,15-/m1/s1 |
| InChIKey | HRJXXFQGZKUUBT-WFHYNEINSA-N |
| XLogP | 1.84 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|