About dipotassium;borono phosphate
dipotassium;borono phosphate (PubChem CID 139258522) has the molecular formula H2BK2O6P
and a molecular weight of 217.99 g/mol. Its IUPAC name is dipotassium;borono phosphate.
Molecular Properties
| Compound Name | dipotassium;borono phosphate |
| PubChem CID | 139258522 |
| Molecular Formula | H2BK2O6P |
| Molecular Weight | 217.99 g/mol |
| Exact Mass | 217.90 |
| IUPAC Name | dipotassium;borono phosphate |
| SMILES | O=P([O-])([O-])OB(O)O.[K+].[K+] |
| InChI | InChI=1S/BH4O6P.2K/c2-1(3)7-8(4,5)6;;/h2-3H,(H2,4,5,6);;/q;2*+1/p-2 |
| InChIKey | UJVMDPRTOMIYAO-UHFFFAOYSA-L |
| XLogP | -9.19 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.99 |
| LogP ≤ 5 | -9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;borono phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;borono phosphate?
The IUPAC name of dipotassium;borono phosphate (CID 139258522) is dipotassium;borono phosphate.
What is the SMILES notation for dipotassium;borono phosphate?
The canonical SMILES for dipotassium;borono phosphate is O=P([O-])([O-])OB(O)O.[K+].[K+].
What is the InChIKey of dipotassium;borono phosphate?
The InChIKey is UJVMDPRTOMIYAO-UHFFFAOYSA-L. The full InChI is InChI=1S/BH4O6P.2K/c2-1(3)7-8(4,5)6;;/h2-3H,(H2,4,5,6);;/q;2*+1/p-2.
What are the key properties of dipotassium;borono phosphate?
dipotassium;borono phosphate has a molecular weight of 217.99 g/mol, XLogP of -9.19, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;borono phosphate is sourced from PubChem (CID 139258522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).