C18H19NO4 — CID 139259926
propan-2-yl (3aS,6aS)-2-benzyl-1,3-dioxo-6,6a-dihydro-3aH-cyclopenta[c]pyrrole-4-carboxylate (PubChem CID 139259926) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is propan-2-yl (3aS,6aS)-2-benzyl-1,3-dioxo-6,6a-dihydro-3aH-cyclopenta[c]pyrrole-4-carboxylate.
| Compound Name | propan-2-yl (3aS,6aS)-2-benzyl-1,3-dioxo-6,6a-dihydro-3aH-cyclopenta[c]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 139259926 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | propan-2-yl (3aS,6aS)-2-benzyl-1,3-dioxo-6,6a-dihydro-3aH-cyclopenta[c]pyrrole-4-carboxylate |
| SMILES | CC(C)OC(=O)C1=CC[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C18H19NO4/c1-11(2)23-18(22)14-9-8-13-15(14)17(21)19(16(13)20)10-12-6-4-3-5-7-12/h3-7,9,11,13,15H,8,10H2,1-2H3/t13-,15-/m0/s1 |
| InChIKey | RJXDURIRDUVMHX-ZFWWWQNUSA-N |
| XLogP | 2.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|