C18H23IO3 — CID 139262057
(1S,2R,6R,8S,9R,12S)-1-hydroxy-4-iodo-2,8,12-trimethyl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadeca-3,13(16)-dien-14-one (PubChem CID 139262057) has the molecular formula C18H23IO3 and a molecular weight of 414.28 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R,12S)-1-hydroxy-4-iodo-2,8,12-trimethyl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadeca-3,13(16)-dien-14-one.
| Compound Name | (1S,2R,6R,8S,9R,12S)-1-hydroxy-4-iodo-2,8,12-trimethyl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadeca-3,13(16)-dien-14-one |
|---|---|
| PubChem CID | 139262057 |
| Molecular Formula | C18H23IO3 |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (1S,2R,6R,8S,9R,12S)-1-hydroxy-4-iodo-2,8,12-trimethyl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadeca-3,13(16)-dien-14-one |
| SMILES | C[C@H]1CC[C@H]2C3=C1C(=O)O[C@@]3(O)[C@@]1(C)C=C(I)C[C@H]1C[C@@H]2C |
| InChI | InChI=1S/C18H23IO3/c1-9-4-5-13-10(2)6-11-7-12(19)8-17(11,3)18(21)15(13)14(9)16(20)22-18/h8-11,13,21H,4-7H2,1-3H3/t9-,10-,11+,13+,17-,18+/m0/s1 |
| InChIKey | VAXJZQCLQCECED-CHEMSCLBSA-N |
| XLogP | 3.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|