C17H26O3 — CID 139263466
(1S,4R)-4-[(1Z,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]cyclohex-2-en-1-ol (PubChem CID 139263466) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (1S,4R)-4-[(1Z,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]cyclohex-2-en-1-ol.
| Compound Name | (1S,4R)-4-[(1Z,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 139263466 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (1S,4R)-4-[(1Z,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]cyclohex-2-en-1-ol |
| SMILES | CC(/C=C\[C@@H]1C=C[C@@H](O)CC1)=C\COC1CCCCO1 |
| InChI | InChI=1S/C17H26O3/c1-14(5-6-15-7-9-16(18)10-8-15)11-13-20-17-4-2-3-12-19-17/h5-7,9,11,15-18H,2-4,8,10,12-13H2,1H3/b6-5-,14-11+/t15-,16-,17?/m1/s1 |
| InChIKey | HBVNKXUHXRSJPF-IOTMJCCCSA-N |
| XLogP | 3.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|